Systematic / IUPAC Name: 1-(2,4-Dinitrophenyl)azepane
ID: Reference7129
Other Names:
(2,4-Dinitrophenyl)azaperhydroepine;
1H-Azepine, 1-(2,4-dinitrophenyl)hexahydro-
Formula: C12H15N3O4
1-(2,4-Dinitrophenyl)azepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 66 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2017 7:30:04 AM |
| InChI | InChI=1S/C12H15N3O4/c16-14(17)10-5-6-11(12(9-10)15(18)19)13-7-3-1-2-4-8-13/h5-6,9H,1-4,7-8H2 |
| InChI Key | INKRSLKJVZILKS-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
(2,4-Dinitrophenyl)azaperhydroepine; 1H-Azepine, 1-(2,4-dinitrophenyl)hexahydro- |
| ChEMBL | CHEMBL1511777 |
| ChemSpider | 2013499 |
| PubChem | 2731658 |