Systematic / IUPAC Name: 5-Oxoprolylhistidylprolinamide
ID: Reference713
Other Names:
5-Oxo-L-prolyl-L-histidyl-L-prolinamide;
Prolinamide, 5-oxoprolylhistidyl-;
L-Pyroglutamyl-L-histidyl-L-proline amide;
Thyroliberin;
Lopremone
; more
Formula: C16H22N6O4
Class: Therapeutics/Prescription Drugs
Protirelin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 261 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2015 1:46:54 PM |
| InChI | InChI=1S/C16H22N6O4/c17-14(24)12-2-1-5-22(12)16(26)11(6-9-7-18-8-19-9)21-15(25)10-3-4-13(23)20-10/h7-8,10-12H,1-6H2,(H2,17,24)(H,18,19)(H,20,23)(H,21,25)/t10-,11-,12-/m0/s1 |
| InChI Key | XNSAINXGIQZQOO-SRVKXCTJSA-N |
| Canonical SMILES | O=C(N)C3N(C(=O)C(NC(=O)C1NC(=O)CC1)Cc2cncn2)CCC3 |
| CAS | 24305279 |
| Splash | |
| Other Names |
5-Oxo-L-prolyl-L-histidyl-L-prolinamide; Prolinamide, 5-oxoprolylhistidyl-; L-Pyroglutamyl-L-histidyl-L-proline amide; Thyroliberin; Lopremone; Rifathyroin; Thypinone; TRF; TRH; Thyrotropin-releasing factor; Stimu TSH; Thyrotropic hormone-releasing factor; Thyrotropic hormone-releasing hormone |
| ChEMBL | CHEMBL1472 |
| Wikipedia | Thyrotropin-releasing_hormone |
| ChemSpider | 554166 |
| HMDb | HMDB05763; HMDB60080 |
| PubChem | 638678 |
| ChemIDPlus | 117217400 |
| KEGG | C03958; D00176 |
| ChEBI | CHEBI:35940 |