Systematic / IUPAC Name: 1-(3-Methylphenyl)-3-(2-pyridinyl)thiourea
ID: Reference7132
Other Names:
N-(3-Methylphenyl)-N'-(2-pyridyl)thiourea ;
Thiourea, N-(3-methylphenyl)-N'-2-pyridinyl-
Formula: C13H13N3S
N-(3-Methylphenyl)-N'-(2-pyridyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2017 2:17:55 PM |
| InChI | InChI=1S/C13H13N3S/c1-10-5-4-6-11(9-10)15-13(17)16-12-7-2-3-8-14-12/h2-9H,1H3,(H2,14,15,16,17) |
| InChI Key | PQYWQBHBAVCIGA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)NC(=S)NC2=CC=CC=N2 |
| CAS | |
| Splash | |
| Other Names |
N-(3-Methylphenyl)-N'-(2-pyridyl)thiourea ; Thiourea, N-(3-methylphenyl)-N'-2-pyridinyl- |
| ChEMBL | CHEMBL1544027 |
| PubChem | 2730970 |
| ChEBI | CHEBI:114752 |
| ChemSpider | 2012887 |