Systematic / IUPAC Name: 2-[(Phenylsulfinyl)methyl]benzoic acid
ID: Reference7140
Other Names:
2-[(Benzenesulfinyl)methyl]benzoic acid;
Benzoic acid, 2-[(phenylsulfinyl)methyl]-
Formula: C14H12O3S
2-[(Phenylsulfinyl)methyl]benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/6/2017 2:13:35 PM |
| InChI | InChI=1S/C14H12O3S/c15-14(16)13-9-5-4-6-11(13)10-18(17)12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| InChI Key | NNURJXUOUNBQCY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)S(=O)CC2=CC=CC=C2C(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-[(Benzenesulfinyl)methyl]benzoic acid; Benzoic acid, 2-[(phenylsulfinyl)methyl]- |