Systematic / IUPAC Name: 6-Chloro-N,N'-diethyl-2,3-quinoxalinediamine
ID: Reference7144
Other Names: 2,3-Quinoxalinediamine, 6-chloro-N2,N3-diethyl-
Formula: C12H15ClN4
6-Chloro-N2,N3-diethylquinoxaline-2,3-diamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2017 11:00:03 AM |
| InChI | InChI=1S/C12H15ClN4/c1-3-14-11-12(15-4-2)17-10-7-8(13)5-6-9(10)16-11/h5-7H,3-4H2,1-2H3,(H,14,16)(H,15,17) |
| InChI Key | LYIMIPNCPHIVIA-UHFFFAOYSA-N |
| Canonical SMILES | CCNC1=NC2=C(C=C(C=C2)Cl)N=C1NCC |
| CAS | |
| Splash | |
| Other Names | 2,3-Quinoxalinediamine, 6-chloro-N2,N3-diethyl- |