Systematic / IUPAC Name: 4-[(2E)-2-(2-Chloro-6-fluorobenzylidene)hydrazino]-6-methyl-1,3,5-triazin-2-amine
ID: Reference7151
Other Names: Benzaldehyde, 2-chloro-6-fluoro-, 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone
Formula: C11H10ClFN6
2-Chloro-6-fluorobenzaldehyde N-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/8/2017 8:22:05 AM |
| InChI | InChI=1S/C11H10ClFN6/c1-6-16-10(14)18-11(17-6)19-15-5-7-8(12)3-2-4-9(7)13/h2-5H,1H3,(H3,14,16,17,18,19)/b15-5+ |
| InChI Key | CJJXXKYOCNSGCP-PJQLUOCWSA-N |
| Canonical SMILES | CC1=NC(=NC(=N1)NN=CC2=C(C=CC=C2Cl)F)N |
| CAS | |
| Splash | |
| Other Names | Benzaldehyde, 2-chloro-6-fluoro-, 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone |
| ChemSpider | 7840998 |
| PubChem | 9566280 |
| ChEMBL | CHEMBL3197390 |