Systematic / IUPAC Name: (2E)-N-(2-Furylmethyl)-2-{[5-(3-nitrophenyl)-2-furyl]methylene}hydrazinecarbothioamide
ID: Reference7154
Other Names: Hydrazinecarbothioamide, N-(2-furanylmethyl)-2-{[5-(3-nitrophenyl)-2-furanyl]methylene}, (2E)-
Formula: C17H14N4O4S
N1-(2-Furylmethyl)-2-{[5-(3-nitrophenyl)-2-furyl]methylidene}hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 72 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/8/2017 11:27:12 AM |
| InChI | InChI=1S/C17H14N4O4S/c22-21(23)13-4-1-3-12(9-13)16-7-6-15(25-16)11-19-20-17(26)18-10-14-5-2-8-24-14/h1-9,11H,10H2,(H2,18,20,26)/b19-11+ |
| InChI Key | VEUOZDDEHGZFKK-YBFXNURJSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarbothioamide, N-(2-furanylmethyl)-2-{[5-(3-nitrophenyl)-2-furanyl]methylene}, (2E)- |
| ChemSpider | 7840859 |
| PubChem | 9566141 |
| ChEMBL | CHEMBL3195185 |