Systematic / IUPAC Name: (11β)-11,17-Dihydroxy-3,20-dioxopregna-1,4-dien-21-yl 3,3-dimethylbutanoate
ID: Reference7174
Other Names:
Hydeltra-T B A;
Predalone T B A;
{2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-Dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl} 3,3-dimethylbutanoate ;
11β,17,21-Trihydroxypregna-1,4-diene-3,20-dione 21-(3,3-dimethylbutyrate);
Prednisolone 21-tert-butylacetate
; more
Formula: C27H38O6
Class: Therapeutics/Prescription Drugs Sports Doping Drugs Steroids/Vitamins/Hormones
Prednisolone tebutate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/13/2017 2:11:17 PM |
| InChI | InChI=1S/C27H38O6/c1-24(2,3)14-22(31)33-15-21(30)27(32)11-9-19-18-7-6-16-12-17(28)8-10-25(16,4)23(18)20(29)13-26(19,27)5/h8,10,12,18-20,23,29,32H,6-7,9,11,13-15H2,1-5H3/t18-,19-,20-,23+,25-,26-,27-/m0/s1 |
| InChI Key | HUMXXHTVHHLNRO-KAJVQRHHSA-N |
| Canonical SMILES | CC12CC(C3C(C1CCC2(C(=O)COC(=O)CC(C)(C)C)O)CCC4=CC(=O)C=CC34C)O |
| CAS | 7681143 |
| Splash | |
| Other Names |
Hydeltra-T B A; Predalone T B A; {2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-Dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl} 3,3-dimethylbutanoate ; 11β,17,21-Trihydroxypregna-1,4-diene-3,20-dione 21-(3,3-dimethylbutyrate); Prednisolone 21-tert-butylacetate; Prednisolone butyl acetete; Prednisolone butylacetate; Pregna-1,4-diene-3,20-dione, 11,17-dihydroxy-21-[(3,3-dimethyl-1-oxobutyl)oxy]-, (11β)- ; Pregna-1,4-diene-3,20-dione, 21-(3,3-dimethyl-1-oxobutoxy)-11,17-dihydroxy-, (11β)- |
| ChemIDPlus | 007681143 |
| ChemSpider | 84007 |
| PubChem | 93055 |
| ChEBI | CHEBI:8381 |
| ChEMBL | CHEMBL1200909 |
| KEGG | C08182; D00982 |