Systematic / IUPAC Name: 3-Carboxy-2,3-dideoxypentaric acid
ID: Reference7183
Other Names:
DL-Isocitric acid;
Pentaric acid, 3-carboxy-2,3-dideoxy-;
1-Hydroxy-1,2,3-propanetricarboxylic acid;
1-Hydroxypropane-1,2,3-tricarboxylic acid;
1-Hydroxytricarballylic acid
Formula: C6H8O7
Isocitric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 115 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/14/2017 1:39:59 PM |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13) |
| InChI Key | ODBLHEXUDAPZAU-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(C(=O)O)O)C(=O)O)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
DL-Isocitric acid; Pentaric acid, 3-carboxy-2,3-dideoxy-; 1-Hydroxy-1,2,3-propanetricarboxylic acid; 1-Hydroxypropane-1,2,3-tricarboxylic acid; 1-Hydroxytricarballylic acid; 3-Carboxy-2,3-dideoxy-1-hydroxypropan-1,2,3-tricarboxylic acid |
| PubChem | 1198 |
| ChEMBL | CHEMBL539669 |
| ChEBI | CHEBI:30887 |
| Wikipedia | Isocitric_acid |
| KEGG | C00311 |
| ChemSpider | 1161 |
| ChemIDPlus | 000320774; 001637736 |
| HMDb | HMDB00193 |