Systematic / IUPAC Name: N,N-Dimethyl-1-(5-oxido-10H-phenothiazin-10-yl)-2-propanamine
ID: Reference7186
Other Names:
Promethazine 5-oxide;
Promethazine sulphoxide;
N,N,α-Trimethyl-10H-phenothiazine-10-ethanamine 5-oxide;
N,N-Dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine;
N-[2-(Dimethylamino)propyl]phenothiazine S-oxide
; more
Formula: C17H20N2OS
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Promethazine sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/18/2017 6:44:39 AM |
| InChI | InChI=1S/C17H20N2OS/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)21(20)17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChI Key | OWTCLFIFAFHQIX-UHFFFAOYSA-N |
| Canonical SMILES | CC(CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31)N(C)C |
| CAS | |
| Splash | |
| Other Names |
Promethazine 5-oxide; Promethazine sulphoxide; N,N,α-Trimethyl-10H-phenothiazine-10-ethanamine 5-oxide; N,N-Dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine; N-[2-(Dimethylamino)propyl]phenothiazine S-oxide; 10-(2-(Dimethylamino)propyl)-10H-phenothiazine 5-oxide; 10H-Phenothiazine-10-ethanamine, N,N,α-trimethyl, 5-oxide; Romergan sulfoxide |
| ChemIDPlus | 007640519 |
| PubChem | 63032 |
| ChemSpider | 56727 |
| ChEMBL | CHEMBL3544889 |