Systematic / IUPAC Name: 1-(Propylsulfinyl)propane
ID: Reference7188
Other Names:
n-Propyl sulfoxide;
1,1'-Sulphinylbispropane;
Di-n-Propyl sulfoxid;
Di-n-Propyl sulfoxide;
Di-n-Propyl sulphoxide
; more
Formula: C6H14OS
Dipropyl sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 111 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/18/2017 6:53:42 AM |
| InChI | InChI=1S/C6H14OS/c1-3-5-8(7)6-4-2/h3-6H2,1-2H3 |
| InChI Key | BQCCJWMQESHLIT-UHFFFAOYSA-N |
| Canonical SMILES | CCCS(=O)CCC |
| CAS | 4253912 |
| Splash | |
| Other Names |
n-Propyl sulfoxide; 1,1'-Sulphinylbispropane; Di-n-Propyl sulfoxid; Di-n-Propyl sulfoxide; Di-n-Propyl sulphoxide; Dipropyl sulphoxide; Propane, 1,1'-sulfinylbis-; Propyl sulfoxide; Sulfoxide, dipropyl |