Systematic / IUPAC Name: 1-Butyl-N-(3-hydroxy-2,6-dimethylphenyl)-2-piperidinecarboxamide
ID: Reference7192
Other Names: 2-Piperidinecarboxamide, 1-butyl-N-(3-hydroxy-2,6-dimethylphenyl)-
Formula: C18H28N2O2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
3-Hydroxybupivicaine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/18/2017 11:29:41 AM |
| InChI | InChI=1S/C18H28N2O2/c1-4-5-11-20-12-7-6-8-15(20)18(22)19-17-13(2)9-10-16(21)14(17)3/h9-10,15,21H,4-8,11-12H2,1-3H3,(H,19,22) |
| InChI Key | APYKFYXYNIYHGU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCN1CCCCC1C(=O)NC2=C(C=CC(=C2C)O)C |
| CAS | |
| Splash | |
| Other Names | 2-Piperidinecarboxamide, 1-butyl-N-(3-hydroxy-2,6-dimethylphenyl)- |