Systematic / IUPAC Name: 10-[3-(Dimethylamino)propyl]-10H-phenothiazin-3-ol
ID: Reference7198
Other Names:
10-[3-(Dimethylamino)propyl]phenothiazin-3-ol;
10H-Phenothiazin-3-ol, 10-[3-(dimethylamino)propyl]-;
Phenothiazin-3-ol, 10-[3-(dimethylamino)propyl]-
Formula: C17H20N2OS
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
3-Hydroxypromazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 204 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/19/2017 12:18:48 PM |
| InChI | InChI=1S/C17H20N2OS/c1-18(2)10-5-11-19-14-6-3-4-7-16(14)21-17-12-13(20)8-9-15(17)19/h3-4,6-9,12,20H,5,10-11H2,1-2H3 |
| InChI Key | FCWHSDRYYOAXGG-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CCCN1C2=C(C=C(C=C2)O)SC3=CC=CC=C31 |
| CAS | |
| Splash | |
| Other Names |
10-[3-(Dimethylamino)propyl]phenothiazin-3-ol; 10H-Phenothiazin-3-ol, 10-[3-(dimethylamino)propyl]-; Phenothiazin-3-ol, 10-[3-(dimethylamino)propyl]- |
| PubChem | 67569 |
| ChemIDPlus | 000316858 |
| ChemSpider | 60891 |
| ChEMBL | CHEMBL3544858 |