Systematic / IUPAC Name: 4-Phenyl-4,5-dihydro-1,3-oxazol-2-amine
ID: Reference7199
Other Names: 2-Oxazolamine, 4,5-dihydro-4-phenyl-
Formula: C9H10N2O
Rexamino mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/19/2017 12:58:13 PM |
| InChI | InChI=1S/C9H10N2O/c10-9-11-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,10,11) |
| InChI Key | ZBFPLELNWIASCT-UHFFFAOYSA-N |
| Canonical SMILES | C1C(N=C(O1)N)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 2-Oxazolamine, 4,5-dihydro-4-phenyl- |
| PubChem | 10654553 |
| ChEMBL | CHEMBL106357 |
| ChemSpider | 8829908 |