Systematic / IUPAC Name: N-Ethyl-1-[3-(trifluoromethyl)phenyl]-2-propanamine
ID: Reference721
Other Names:
N-Ethyl-α-methyl-3-trifluoromethylphenethylamine;
3-(Trifluoromethyl)-N-ethyl-α-methylphenethylamine;
1-(m-Trifluoromethyl-phenyl)-2 ethylaminopropane;
Phenethylamine, N-ethyl-α-methyl-m-(trifluoromethyl)-;
Fenfluramina
; more
Formula: C12H16F3N
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Fenfluramine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 172 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2018 9:41:25 AM |
| InChI | InChI=1S/C12H16F3N/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3 |
| InChI Key | DBGIVFWFUFKIQN-UHFFFAOYSA-N |
| Canonical SMILES | CCNC(C)CC1=CC(=CC=C1)C(F)(F)F |
| CAS | 458242 |
| Splash | |
| Other Names |
N-Ethyl-α-methyl-3-trifluoromethylphenethylamine; 3-(Trifluoromethyl)-N-ethyl-α-methylphenethylamine; 1-(m-Trifluoromethyl-phenyl)-2 ethylaminopropane; Phenethylamine, N-ethyl-α-methyl-m-(trifluoromethyl)-; Fenfluramina; Adifax; Obedrex; Rotondin; Acino; Pesos |
| KEGG | C06996; D07945 |
| ChemIDPlus | 000458242; 003239449; 005220893 |
| PubChem | 3337 |
| Wikipedia | Fenfluramine |
| DrugBank | APRD00319; APRD00648 |
| ChEMBL | CHEMBL87493 |
| ChemSpider | 3220; 21240517 |
| ChEBI | CHEBI:5000 |
| Cayman | 22491 |