Systematic / IUPAC Name: 2-{[(4-Hydroxy-2-methyl-1,1-dioxido-2H-1,2-benzothiazin-3-yl)carbonyl]amino}-1,3-thiazole-5-carboxylic acid
ID: Reference7217
Other Names:
5'-Carboxy meloxicam;
2-{[(4-Hydroxy-2-methyl-1,1-dioxido-2H-1,2-benzothiazin-3-yl)carbonyl]amino}-5-thiazolecarboxylic acid
Formula: C14H11N3O6S2
Class: Therapeutics/Prescription Drugs
5-Carboxymeloxicam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/4/2018 8:48:14 AM |
| InChI | InChI=1S/C14H11N3O6S2/c1-17-10(12(19)16-14-15-6-8(24-14)13(20)21)11(18)7-4-2-3-5-9(7)25(17,22)23/h2-6,18H,1H3,(H,20,21)(H,15,16,19) |
| InChI Key | MTQQFYLGAZXHTB-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)NC3=NC=C(S3)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
5'-Carboxy meloxicam; 2-{[(4-Hydroxy-2-methyl-1,1-dioxido-2H-1,2-benzothiazin-3-yl)carbonyl]amino}-5-thiazolecarboxylic acid |