Systematic / IUPAC Name: (6α)-17,21-Dihydroxy-6-methylpregna-1,4-diene-3,11,20-trione
ID: Reference7219
Other Names:
(6S,8S,9S,10R,13S,14S,17R)-17-Hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione;
17,21-Dihydroxy-6α-methylpregna-1,4-diene-3,11,20-trione;
6a-Methyl prednisone;
Prednisone, 6α-methyl-;
Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy-6α-methyl-
; more
Formula: C22H28O5
Class: Therapeutics/Prescription Drugs
6α-Methylprednisone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 135 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/4/2018 1:54:42 PM |
| InChI | InChI=1S/C22H28O5/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20/h4,6,9,12,14-15,19,23,27H,5,7-8,10-11H2,1-3H3/t12-,14-,15-,19+,20-,21-,22-/m0/s1 |
| InChI Key | SVYCRJXQZUCUND-PQXSVQADSA-N |
| Canonical SMILES | CC1CC2C3CCC(C3(CC(=O)C2C4(C1=CC(=O)C=C4)C)C)(C(=O)CO)O |
| CAS | |
| Splash | |
| Other Names |
(6S,8S,9S,10R,13S,14S,17R)-17-Hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione; 17,21-Dihydroxy-6α-methylpregna-1,4-diene-3,11,20-trione; 6a-Methyl prednisone; Prednisone, 6α-methyl-; Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy-6α-methyl-; Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy-6-methyl-, (6α)-; 6-α-Methylprednisone |