Systematic / IUPAC Name: {3-[2-(tert-Butylamino)-1-hydroxyethyl]-5-(dimethylcarbamoyloxy)phenyl} N,N-dimethylcarbamate
ID: Reference7232
Other Names:
Bambudil;
Bambuterolum;
N,N-Dimethylcarbamic acid {3-[2-(tert-butylamino)-1-hydroxyethyl]-5-[dimethylamino(oxo)methoxy]phenyl} ester ;
5-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,3-diyl bis(dimethylcarbamate);
5-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}-1,3-phenylene bis(dimethylcarbamate)
; more
Formula: C18H29N3O5
Class: Therapeutics/Prescription Drugs
Bambuterol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/9/2018 10:39:52 AM |
| InChI | InChI=1S/C18H29N3O5/c1-18(2,3)19-11-15(22)12-8-13(25-16(23)20(4)5)10-14(9-12)26-17(24)21(6)7/h8-10,15,19,22H,11H2,1-7H3 |
| InChI Key | ANZXOIAKUNOVQU-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O |
| CAS | |
| Splash | |
| Other Names |
Bambudil; Bambuterolum; N,N-Dimethylcarbamic acid {3-[2-(tert-butylamino)-1-hydroxyethyl]-5-[dimethylamino(oxo)methoxy]phenyl} ester ; 5-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,3-diyl bis(dimethylcarbamate); 5-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}-1,3-phenylene bis(dimethylcarbamate); Terbutaline bis(dimethylcarbamate); Terbutaline bisdimethylcarbamate |
| PubChem | 54766 |
| ChemSpider | 49466 |
| KEGG | D07377 |
| Wikipedia | Bambuterol |
| DrugBank | DB01408 |
| HMDb | HMDB15478 |
| ChEMBL | CHEMBL521589 |
| ChemIDPlus | 081732652 |
| ChEBI | CHEBI:553827 |