Systematic / IUPAC Name: 4-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}-1,2-phenylene bis(4-methylbenzoate)
ID: Reference7235
Other Names:
Bitolterolum;
{4-[2-(tert-Butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl} 4-methylbenzoate ;
4-[2-(tert-Butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate ;
4-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate);
4-{2-[(1,1-Dimethylethyl)amino]-1-hydroxyethyl}benzene-1,2-diyl bis(4-methylbenzoate)
; more
Formula: C28H31NO5
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Bitolterol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/9/2018 12:27:49 PM |
| InChI | InChI=1S/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3 |
| InChI Key | FZGVEKPRDOIXJY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C |
| CAS | |
| Splash | |
| Other Names |
Bitolterolum; {4-[2-(tert-Butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl} 4-methylbenzoate ; 4-[2-(tert-Butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate ; 4-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate); 4-{2-[(1,1-Dimethylethyl)amino]-1-hydroxyethyl}benzene-1,2-diyl bis(4-methylbenzoate); 5-[2-(tert-Butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyloxy)phenyl 4-methylbenzoate; Benzoic acid, 4-methyl, 4-{2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl}-1,2-phenylene ester ; Bis(4-methylbenzoic acid) 4-[2-(tert-butylamino)-1-hydroxyethyl]-1,2-phenylene ester |
| Wikipedia | Bitolterol |
| ChemIDPlus | 030392406 |
| DrugBank | DB00901 |
| ChEBI | CHEBI:3133 |
| PubChem | 35330 |
| KEGG | D07534; C06853 |
| ChEMBL | CHEMBL1201295 |
| ChemSpider | 32525 |