Systematic / IUPAC Name: [1-(Aminomethyl)cyclohexyl]acetic acid
ID: Reference725
Other Names:
2-[1-(Aminomethyl)cyclohexyl]acetic acid;
Cyclohexaneacetic acid, 1-(aminomethyl)-;
2-[(Aminomethyl)cyclohexyl]acetic acid;
Neurontin;
Gabapentine
; more
Formula: C9H17NO2
Class: Therapeutics/Prescription Drugs
Gabapentin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 226 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2015 3:14:51 PM |
| InChI | InChI=1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) |
| InChI Key | UGJMXCAKCUNAIE-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(CC(=O)O)CN |
| CAS | 60142963 |
| Splash | |
| Other Names |
2-[1-(Aminomethyl)cyclohexyl]acetic acid; Cyclohexaneacetic acid, 1-(aminomethyl)-; 2-[(Aminomethyl)cyclohexyl]acetic acid; Neurontin; Gabapentine; Aclonium; Gabapen |