Systematic / IUPAC Name: 4-(2-Methyl-2-propanyl)phenyl salicylate
ID: Reference7250
Other Names:
Seesorb 202;
Sumisorb 90;
Viosorb 90;
p-tert-Butylphenyl salicylate;
4-(tert-Butyl)phenyl 2-hydroxybenzoate
; more
Formula: C17H18O3
Class: Extractables/Leachables
4-tert-Butylphenyl salicylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 453 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 8:57:27 AM |
| InChI | InChI=1S/C17H18O3/c1-17(2,3)12-8-10-13(11-9-12)20-16(19)14-6-4-5-7-15(14)18/h4-11,18H,1-3H3 |
| InChI Key | DBOSBRHMHBENLP-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O |
| CAS | 87183 |
| Splash | |
| Other Names |
Seesorb 202; Sumisorb 90; Viosorb 90; p-tert-Butylphenyl salicylate; 4-(tert-Butyl)phenyl 2-hydroxybenzoate; 4-(tert-Butylphenyl) salicyclate; 4-tert-Butylphenyl 2-hydroxybenzoate; 4-tert-Butylphenyl salicylate; Benzoic acid, 2-hydroxy, 4-(1,1-dimethylethyl)phenyl ester; Salicyclic acid p-tert-butylphenyl ester; Salicylic acid 4-tert-butylphenyl ester; Salicylic acid, p-tert-butylphenyl ester |
| ChEMBL | CHEMBL3186746 |
| HMDb | HMDB41314 |
| PubChem | 66597 |
| ChemSpider | 59965 |
| ChemIDPlus | 000087183 |