Systematic / IUPAC Name: 1,3-Diisocyanato-2-methylbenzene
ID: Reference7257
Other Names:
2,6-TDI;
Desmodur T 80;
Hylene-T ;
Mondur-TD ;
Nacconate-100
; more
Formula: C9H6N2O2
Class: Extractables/Leachables
2,6-Toluene diisocyanate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1978 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:40:32 AM |
| InChI | InChI=1S/C9H6N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2-4H,1H3 |
| InChI Key | RUELTTOHQODFPA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC=C1N=C=O)N=C=O |
| CAS | 91087 |
| Splash | |
| Other Names |
2,6-TDI; Desmodur T 80; Hylene-T ; Mondur-TD ; Nacconate-100; Rubinate TDI ; m-Tolylene diisocyanate; m-Tolylidene diisocyanate; 1,3-Diisocyanato-2-methyl-benzene; 1,3-Diisocyanatomethylbenzene; 2,6-Diisocyanato-1-methylbenzene; 2,6-Diisocyanatotoluene; 2,6-Toluenediisocyanate; 2,6-Tolylene diisocyanate; 2-Methyl-m-phenylene diisocyanate; 2-Methyl-m-phenylene isocyanate; Benzene, 1,3-diisocyanato-2-methyl-; Benzene, 2,6-diisocyanato-1-methyl-; Diisocyanatotoluene; Isocyanic acid, 2-methyl-m-phenylene ester; Isocyanic acid, methyl-m-phenylene ester; Methyl-m-phenylene diisocyanate; Methyl-m-phenylene isocyanate; Methylphenylene isocyanate; Toluene 2,6-diisocyanate; Tolylene 2,6-diisocyanate; Tolylene isocyanate |
| ChemIDPlus | 000091087; 009019856; 031370613; 037302708; 063368956; 051160362; 053679542; 066072228; 052390757; 009017010 |
| Wikipedia | Toluene_diisocyanate |
| ChEMBL | CHEMBL1443390 |
| PubChem | 7040 |
| ChemSpider | 6773 |
| ChEBI | CHEBI:53557 |