Systematic / IUPAC Name: 6-Phenyl-1,3,5-triazine-2,4-diamine
ID: Reference7260
Other Names:
S-Triazine, 2,4-diamino-6-phenyl-;
1,3,5-Triazine, 2,4-diamino-6-phenyl-;
1,3,5-Triazine-2,4-diamine, 6-phenyl-;
2,4-Diamino-6-phenyl-S-triazine;
2,4-Diamino-6phenyl-1,3,5-triazine
; more
Formula: C9H9N5
Class: Extractables/Leachables
Benzoguanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 208 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:41:06 AM |
| InChI | InChI=1S/C9H9N5/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6/h1-5H,(H4,10,11,12,13,14) |
| InChI Key | GZVHEAJQGPRDLQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N)N |
| CAS | 91769 |
| Splash | |
| Other Names |
S-Triazine, 2,4-diamino-6-phenyl-; 1,3,5-Triazine, 2,4-diamino-6-phenyl-; 1,3,5-Triazine-2,4-diamine, 6-phenyl-; 2,4-Diamino-6-phenyl-S-triazine; 2,4-Diamino-6phenyl-1,3,5-triazine; 2,6-Diamino-4-phenyl-1,3,5-triazine; 2-Phenyl-4,6-diamino-S-triazine; 2-Phenyl-4,6-diamino-1,3,5-triazine; 4,6-Diamino-2-phenyl-S-triazine; 4-Imino-6-phenyl-4,5-dihydro-1,3,5-triazin-2-amine; 6-Phenyl-1,3,5-triazine-2,4-diyldiamine; Benzoguanimine; BZE |
| ChEMBL | CHEMBL337319 |
| ChemSpider | 6797 |
| ChemIDPlus | 000091769 |
| PubChem | 7064 |