Systematic / IUPAC Name: (1R,9S,15S)-15-Amino-1-methyltricyclo[7.5.1.02,7]pentadeca-2,4,6-trien-4-ol
ID: Reference7263
Other Names:
Dezocinum;
(-)-13β-Amino-5,6,7,8,9,10,11α,12-octahydro-5α-methyl-5,11-methanobenzocyclodecen-3-ol;
(5R,11S,13S)-13-Amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzo[10]annulen-3-ol;
(5R,11S,13S)-13-Amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzocyclodecen-3-ol
Formula: C16H23NO
Class: Therapeutics/Prescription Drugs
Dezocine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/16/2018 9:46:25 AM |
| InChI | InChI=1S/C16H23NO/c1-16-8-4-2-3-5-12(15(16)17)9-11-6-7-13(18)10-14(11)16/h6-7,10,12,15,18H,2-5,8-9,17H2,1H3/t12-,15-,16+/m0/s1 |
| InChI Key | VTMVHDZWSFQSQP-VBNZEHGJSA-N |
| Canonical SMILES | CC12CCCCCC(C1N)CC3=C2C=C(C=C3)O |
| CAS | 53648558 |
| Splash | |
| Other Names |
Dezocinum; (-)-13β-Amino-5,6,7,8,9,10,11α,12-octahydro-5α-methyl-5,11-methanobenzocyclodecen-3-ol; (5R,11S,13S)-13-Amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzo[10]annulen-3-ol; (5R,11S,13S)-13-Amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzocyclodecen-3-ol |
| DrugBank | DB01209 |
| ChEMBL | CHEMBL1685 |
| Wikipedia | Dezocine |
| ChEBI | CHEBI:4474 |
| HMDb | HMDB15340 |
| KEGG | D00838; C08010 |
| PubChem | 3033053 |
| ChemSpider | 2297867 |