Systematic / IUPAC Name: 2-(Diethylamino)ethyl cyclohexyl(phenyl)acetate
ID: Reference7267
Other Names:
Adiphenine H;
Cycloadiphene;
Cycloadiphenine;
Hexahydroadiphenine;
α-Cyclohexylbenzeneacetic acid 2-(diethylamino)ethyl ester
; more
Formula: C20H31NO2
Class: Therapeutics/Prescription Drugs
Drofenine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/17/2018 7:58:58 AM |
| InChI | InChI=1S/C20H31NO2/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5,7-8,11-12,18-19H,3-4,6,9-10,13-16H2,1-2H3 |
| InChI Key | AGJBLWCLQCKRJP-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCOC(=O)C(C1CCCCC1)C2=CC=CC=C2 |
| CAS | 1679761 |
| Splash | |
| Other Names |
Adiphenine H; Cycloadiphene; Cycloadiphenine; Hexahydroadiphenine; α-Cyclohexylbenzeneacetic acid 2-(diethylamino)ethyl ester; α-Phenylcyclohexaneacetic acid 2-(diethylamino)ethyl ester; 2-(Diethylamino)ethyl α-cyclohexylbenzeneacetate; 2-(Diethylamino)ethyl α-phenylcyclohexaneacetate; 2-(Diethylamino)ethyl 2-cyclohexyl-2-phenylacetate; 2-(Diethylamino)ethyl cyclohexylphenylacetate; 2-Cyclohexyl-2-phenylacetic acid 2-(diethylamino)ethyl ester; Benzeneacetic acid, α-cyclohexyl-, 2-(diethylamino)ethyl ester; Cyclohexaneacetic acid, α-phenyl-, 2-(diethylamino)ethyl ester |
| ChEMBL | CHEMBL442444 |
| PubChem | 3166 |
| ChemIDPlus | 001679761 |
| ChEBI | CHEBI:93825 |
| Wikipedia | Drofenin (DE) |
| ChemSpider | 3054 |