Systematic / IUPAC Name: 2,2'-[1,3-Phenylenebis(oxymethylene)]dioxirane
ID: Reference7270
Other Names:
DGRE;
Diglycidyl resorcinol ether;
Diglycidylresorcinol;
RDGE;
Resorcinol glycidyl ether
; more
Formula: C12H14O4
Class: Extractables/Leachables
Resorcinol diglycidyl ether mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 6373 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:44:06 AM |
| InChI | InChI=1S/C12H14O4/c1-2-9(13-5-11-7-15-11)4-10(3-1)14-6-12-8-16-12/h1-4,11-12H,5-8H2 |
| InChI Key | WPYCRFCQABTEKC-UHFFFAOYSA-N |
| Canonical SMILES | C1C(O1)COC2=CC(=CC=C2)OCC3CO3 |
| CAS | 101906 |
| Splash | |
| Other Names |
DGRE; Diglycidyl resorcinol ether; Diglycidylresorcinol; RDGE; Resorcinol glycidyl ether; Resorcinol, diglycidyl-; Resorcinyl diglycidyl ether; m-Bis(2,3-epoxypropoxy)benzene; m-Bis(glycidyloxy)benzene; 1,3-Bis(2,3-epoxypropoxy)benzene; 1,3-Bis(glycidyloxy)benzene; 1,3-Bis(oxiran-2-ylmethoxy)benzene; 1,3-Diglycidyloxybenzene; 2-([3-(2-Oxiranylmethoxy)phenoxy]methyl)oxirane; 2,2'-[1,3-Phenylenebis(oxymethylene)]bisoxirane; 2-{[3-(Oxiran-2-ylmethoxy)phenoxy]methyl}oxirane ; 2-[3-(Oxiran-2-ylmethoxy)phenoxymethyl]oxirane; Oxirane, 2,2'-[1,3-phenylenebis(oxymethylene)]bis-; Resorcinol bis(2,3-epoxypropyl) ether |
| KEGG | C19228 |
| ChEBI | CHEBI:82318 |
| PubChem | 7586 |
| ChemIDPlus | 000101906 |
| ChemSpider | 7305 |
| ChEMBL | CHEMBL1338613 |