Systematic / IUPAC Name: 2-Ethylpyridine-4-carbothioamide
ID: Reference7276
Other Names:
Aethionamidum;
Aetina;
Aetiva;
Amidazin;
Amidazine
; more
Formula: C8H10N2S
Class: Therapeutics/Prescription Drugs
Ethionamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/22/2018 11:49:31 AM |
| InChI | InChI=1S/C8H10N2S/c1-2-7-5-6(8(9)11)3-4-10-7/h3-5H,2H2,1H3,(H2,9,11) |
| InChI Key | AEOCXXJPGCBFJA-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=NC=CC(=C1)C(=S)N |
| CAS | 536334 |
| Splash | |
| Other Names |
Aethionamidum; Aetina; Aetiva; Amidazin; Amidazine; Atina; Ethatyl; Ethimide; Ethina; Ethionamidum; Ethyonomide; Etimid; Etiocidan; Etionamid; Etionamida; Etioniamid; Etionid; Etionizin; Etionizina; Etionizine; Fatoliamid; Iridocin; Iridozin; Isothin; Isotiamida; Itiocide; Nicotion; Nisotin; Nizotin; Rigenicid; Sertinon; Teberus; Thianid; Thianide; Thiodine; Thiomid; Thioniden; Tianid; Tiomid; Trecator-SC; Trescatyl; Tubermin; Tuberoid; Tuberoson; α-Ethylisonicotinic acid thioamide; α-Ethylisonicotinoylthioamide; α-Ethylisothionicotinamide; α-Ethylthioisonicotinamide; 2-Ethyl-4-aminothiocarbonylpyridine; 2-Ethyl-4-pyridinecarbothioamide; 2-Ethyl-4-thioamidylpyridine; 2-Ethyl-4-thiocarbamoylpyridine; 2-Ethyl-4-thiopyridylamide; 2-Ethylisonicotinic acid thioamide; 2-Ethylisonicotinic acid thiomide; 2-Ethylisonicotinic thioamide; 2-Ethylisonicotinothiamide; 2-Ethylisonicotinothioamide; 2-Ethylisonicotinoylthioamide; 2-Ethylisonicotinthioamide; 2-Ethylisothionicotinamide; 2-Ethylthioisonicotinamide; 3-Ethylisothionicotinamide; 4-Pyridinecarbothioamide, 2-ethyl-; Amino(2-ethyl(4-pyridyl))methane-1-thione; Ethinamide; Ethioniamide; Ethylisothiamide; Etionamide; Isonicotinamide, 2-ethyl, thio-; Isonicotinamide, 2-ethylthio-; Isonicotinimidic acid, 2-ethylthio-; Trescazide; Tubenamide |
| DrugBank | DB00609 |
| ChEMBL | CHEMBL1441 |
| KEGG | C07665; D00591 |
| PubChem | 2761171 |
| ChEBI | CHEBI:4885 |
| Wikipedia | Ethionamide |
| ChemIDPlus | 000536334 |
| HMDb | HMDB14747 |
| ChemSpider | 2041901 |