Systematic / IUPAC Name: 3-[4-(1-Carboxyethyl)phenyl]-2-methylpropanoic acid
ID: Reference7301
Other Names:
Carboxyibuprofen;
Ibuprofen COOH;
2-[4-(2-Carboxypropyl)phenyl]propionic acid ;
2,4'-(2-Carboxypropyl)phenylpropionic acid;
Benzenepropanoic acid, 4-(1-carboxyethyl)-α-methyl-
Formula: C13H16O4
Class: Therapeutics/Prescription Drugs
Ibuprofen metabolite B mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 182 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/31/2018 10:57:04 AM |
| InChI | InChI=1S/C13H16O4/c1-8(12(14)15)7-10-3-5-11(6-4-10)9(2)13(16)17/h3-6,8-9H,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChI Key | DIVLBIVDYADZPL-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC=C(C=C1)C(C)C(=O)O)C(=O)O |
| CAS | 15935543 |
| Splash | |
| Other Names |
Carboxyibuprofen; Ibuprofen COOH; 2-[4-(2-Carboxypropyl)phenyl]propionic acid ; 2,4'-(2-Carboxypropyl)phenylpropionic acid; Benzenepropanoic acid, 4-(1-carboxyethyl)-α-methyl-; Ibuprofen carboxylic acid |
| ChEBI | CHEBI:133199 |
| ChEMBL | CHEMBL3544650 |
| HMDb | HMDB60564 |
| ChemSpider | 8619532 |
| PubChem | 10444113 |