Systematic / IUPAC Name: 3-{(1R,2R)-2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl}phenol
ID: Reference7314
Other Names:
(-)-O-Desmethyl tramadol;
O-Desmethyl tramadol;
2-[(Dimethylamino)methyl]-1-(3-hydroxyphenyl)cyclohexanol
Formula: C15H23NO2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
O-Desmethyl-cis-tramadol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 311 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2018 11:20:01 AM |
| InChI | InChI=1S/C15H23NO2/c1-16(2)11-13-6-3-4-9-15(13,18)12-7-5-8-14(17)10-12/h5,7-8,10,13,17-18H,3-4,6,9,11H2,1-2H3/t13-,15+/m1/s1 |
| InChI Key | UWJUQVWARXYRCG-HIFRSBDPSA-N |
| Canonical SMILES | CN(C)CC1CCCCC1(C2=CC(=CC=C2)O)O |
| CAS | |
| Splash | |
| Other Names |
(-)-O-Desmethyl tramadol; O-Desmethyl tramadol; 2-[(Dimethylamino)methyl]-1-(3-hydroxyphenyl)cyclohexanol |
| ChemSpider | 8014523 |
| PubChem | 9838803 |
| ChEMBL | CHEMBL1400 |
| Wikipedia | Desmetramadol |