Systematic / IUPAC Name: 1-(1-Phenylcyclohexyl)pyrrolidine
ID: Reference7332
Other Names:
Pyrrolidine analog of phencyclidine;
Roliciclidina;
Rolicyclidinum;
Pyrrolidine, 1-(1-phenylcyclohexyl);
PCP pyrrolidine analog
Formula: C16H23N
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Rolicyclidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2018 1:21:46 PM |
| InChI | InChI=1S/C16H23N/c1-3-9-15(10-4-1)16(11-5-2-6-12-16)17-13-7-8-14-17/h1,3-4,9-10H,2,5-8,11-14H2 |
| InChI Key | FYOWWXMGDATDQY-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(C2=CC=CC=C2)N3CCCC3 |
| CAS | |
| Splash | |
| Other Names |
Pyrrolidine analog of phencyclidine; Roliciclidina; Rolicyclidinum; Pyrrolidine, 1-(1-phenylcyclohexyl); PCP pyrrolidine analog; PCPy |
| ChemIDPlus | 002201390 |
| ChemSpider | 56218 |
| Wikipedia | Rolicyclidine |
| DrugBank | DB01549 |
| PubChem | 62436 |
| ChEMBL | CHEMBL1719398 |
| ChEBI | CHEBI:60805 |