Systematic / IUPAC Name: [1-(5-Fluoropentyl)indazol-3-yl]-pyrrolidin-1-ylmethanone
ID: Reference7350
Other Names: [1-(5-fluoropentyl)-1H-indazol-3-yl](pyrrolidin-1-yl)methanone
Formula: C17H22FN3O
Class: Drugs of Abuse/Illegal Drugs
5-Fluoro PY-PINACA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2018 8:48:27 AM |
| InChI | InChI=1S/C17H22FN3O/c18-10-4-1-5-13-21-15-9-3-2-8-14(15)16(19-21)17(22)20-11-6-7-12-20/h2-3,8-9H,1,4-7,10-13H2 |
| InChI Key | GSCLIRQNUBFUJA-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(C1)C(=O)C2=NN(C3=CC=CC=C32)CCCCCF |
| CAS | |
| Splash | |
| Other Names | [1-(5-fluoropentyl)-1H-indazol-3-yl](pyrrolidin-1-yl)methanone |
| PubChem | 125181281 |