Systematic / IUPAC Name: (S)-N-[1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-1-methyl-1H-pyrazol-5-yl)furan-2-carboxamide
ID: Reference7351
Other Names: 4-Fluoro MDMB-PINACA
Formula: C20H28FN3O3
Class: Drugs of Abuse/Illegal Drugs
4-fluoro ADB mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2018 9:06:13 AM |
| InChI | InChI=1S/C20H28FN3O3/c1-13(21)9-8-12-24-15-11-7-6-10-14(15)16(23-24)18(25)22-17(19(26)27-5)20(2,3)4/h6-7,10-11,13,17H,8-9,12H2,1-5H3,(H,22,25)/t13?,17-/m1/s1 |
| InChI Key | UVZIIUNEZHXUMY-LRHAYUFXSA-N |
| Canonical SMILES | O=C(N[C@H](C(OC)=O)C(C)(C)C)C1=NN(CCCC(F)C)C2=C1C=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-Fluoro MDMB-PINACA |