Systematic / IUPAC Name: 2-(3,4-Dichlorophenyl)-N-methyl-N-[2-(1-pyrrolidinyl)ethyl]ethanamine
ID: Reference7354
Other Names:
Dempea;
[2-(3,4-Dichlorophenyl)ethyl](methyl)[2-(pyrrolidin-1-yl)ethyl]amine;
[2-(3,4-Dichloro-phenyl)-ethyl]-methyl-(2-pyrrolidin-1-yl-ethyl)-amine;
N-[2-(3,4-Dichlorophenyl)ethyl]-N-methyl-1-pyrrolidineethanamine ;
N-[2-(3,4-Dichlorophenyl)ethyl]-N-methyl-2-(1-pyrrolidinyl)ethylamine
; more
Formula: C15H22Cl2N2
Class: Drugs of Abuse/Illegal Drugs
BD 1008 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2018 9:21:28 AM |
| InChI | InChI=1S/C15H22Cl2N2/c1-18(10-11-19-7-2-3-8-19)9-6-13-4-5-14(16)15(17)12-13/h4-5,12H,2-3,6-11H2,1H3 |
| InChI Key | ASGIQUHBAVIOTI-UHFFFAOYSA-N |
| Canonical SMILES | CN(CCC1=CC(=C(C=C1)Cl)Cl)CCN2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
Dempea; [2-(3,4-Dichlorophenyl)ethyl](methyl)[2-(pyrrolidin-1-yl)ethyl]amine; [2-(3,4-Dichloro-phenyl)-ethyl]-methyl-(2-pyrrolidin-1-yl-ethyl)-amine; N-[2-(3,4-Dichlorophenyl)ethyl]-N-methyl-1-pyrrolidineethanamine ; N-[2-(3,4-Dichlorophenyl)ethyl]-N-methyl-2-(1-pyrrolidinyl)ethylamine ; 1-Pyrrolidineethanamine, N-[2-(3,4-dichlorophenyl)ethyl]-N-methyl- ; 2-(3,4-Dichlorophenyl)-N-methyl-N-(2-pyrrolidin-1-ylethyl)ethanamine |
| PubChem | 126388 |
| ChemIDPlus | 138356088 |
| Wikipedia | BD-1008 |
| ChEBI | CHEBI:92304 |
| ChemSpider | 112324 |
| ChEMBL | CHEMBL20377 |