Systematic / IUPAC Name: (4-Methylphenyl)-phenylmethanone
ID: Reference7367
Other Names:
4-Methybenzophenone;
(4-Methylphenyl)(phenyl)methanone;
(4-Methylphenyl)phenylmethanone;
p-Benzophenone, methyl-;
p-Benzoyltoluene
; more
Formula: C14H12O
Class: Extractables/Leachables
4-Methylbenzophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:59:58 AM |
| InChI | InChI=1S/C14H12O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChI Key | WXPWZZHELZEVPO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| CAS | 134849 |
| Splash | |
| Other Names |
4-Methybenzophenone; (4-Methylphenyl)(phenyl)methanone; (4-Methylphenyl)phenylmethanone; p-Benzophenone, methyl-; p-Benzoyltoluene; p-Methylbenzophenone; 4-Benzoyltoluene; 4-Methyl benzophenone; 4-Methylphenyl phenyl ketone; Benzophenone, 4-methyl-; Methanone, (4-methylphenyl)phenyl-; Phenyl p-tolyl ketone; Phenyl(p-tolyl)methanone; Phenyl-p-tolyl-methanone |
| ChEMBL | CHEMBL371531 |
| ChemSpider | 8330 |
| ChemIDPlus | 000134849 |
| PubChem | 8652 |