Systematic / IUPAC Name: Dodecyl 3,4,5-trihydroxybenzoate
ID: Reference7373
Other Names:
E312;
E-312 Antioxidant;
Antioxidant E-312;
Nipagallin LA;
Progallin LA
; more
Formula: C19H30O5
Class: Extractables/Leachables
Dodecyl gallate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:02:54 AM |
| InChI | InChI=1S/C19H30O5/c1-2-3-4-5-6-7-8-9-10-11-12-24-19(23)15-13-16(20)18(22)17(21)14-15/h13-14,20-22H,2-12H2,1H3 |
| InChI Key | RPWFJAMTCNSJKK-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| CAS | 1166525 |
| Splash | |
| Other Names |
E312; E-312 Antioxidant; Antioxidant E-312; Nipagallin LA; Progallin LA; n-Dodecyl gallate; 3,4,5-Trihydroxybenzoic acid, dodecyl ester; Benzoic acid, 3,4,5-trihydroxy, dodecyl ester; Dodecyl 3,4,5-tris(oxidanyl)benzoate; Dodecyl-3,4,5-trihydroxybenzoate; Dodecylgallate; Gallic acid n-dodecyl ester; Gallic acid dodecyl ester; Gallic acid lauryl ester; Gallic acid, n-dodecyl ester; Lauryl 3,4,5-trihydroxybenzoate; Lauryl gallate |
| PubChem | 14425 |
| ChemSpider | 13777 |
| ChEMBL | CHEMBL16121 |
| HMDb | HMDB38720 |
| ChemIDPlus | 001166525 |
| Wikipedia | Dodecyl gallate |