Systematic / IUPAC Name: (5ξ,9ξ,16ξ)-17-Hydroxykauran-19-oic acid
ID: Reference7379
Other Names: (5S,9R)-14-(Hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.0¹,¹°.04,?]hexadecane-5-carboxylic acid
Formula: C20H32O3
(5ξ,9ξ,16ξ)-17-Hydroxykauran-19-oic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 7199 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/12/2018 8:33:50 AM |
| InChI | InChI=1S/C20H32O3/c1-18-7-3-8-19(2,17(22)23)15(18)6-9-20-10-13(4-5-16(18)20)14(11-20)12-21/h13-16,21H,3-12H2,1-2H3,(H,22,23)/t13?,14?,15?,16?,18-,19-,20?/m0/s1 |
| InChI Key | HHAMKMUMKLXDFQ-KFRFNOKNSA-N |
| Canonical SMILES | CC12CCCC(C1CCC34C2CCC(C3)C(C4)CO)(C)C(=O)O |
| CAS | |
| Splash | |
| Other Names | (5S,9R)-14-(Hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.0¹,¹°.04,?]hexadecane-5-carboxylic acid |