Systematic / IUPAC Name: Methyl 10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate
ID: Reference7383
Other Names: Urs-12-en-28-oic acid, 3-(acetyloxy)-, methyl ester
Formula: C33H52O4
Methyl 3-acetoxyurs-12-en-28-oate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3068 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/12/2018 1:17:08 PM |
| InChI | InChI=1S/C33H52O4/c1-20-12-17-33(28(35)36-9)19-18-31(7)23(27(33)21(20)2)10-11-25-30(6)15-14-26(37-22(3)34)29(4,5)24(30)13-16-32(25,31)8/h10,20-21,24-27H,11-19H2,1-9H3 |
| InChI Key | HLBZSQOUBVLLLL-UHFFFAOYSA-N |
| Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2C1C)C)C(=O)OC |
| CAS | |
| Splash | |
| Other Names | Urs-12-en-28-oic acid, 3-(acetyloxy)-, methyl ester |