Systematic / IUPAC Name: 4-{[5-(6-Hydroxy-5,5,8a-trimethyl-2-methylenedecahydro-1-naphthalenyl)-3-methylpentyl]oxy}-4-oxobutanoic acid
ID: Reference7392
Other Names: Butanedioic acid, mono[5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methylpentyl] ester
Formula: C24H40O5
4-{[5-(6-Hydroxy-5,5,8a-trimethyl-2-methylenedecahydro-1-naphthalenyl)-3-methylpentyl]oxy}-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5035 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2018 9:15:09 AM |
| InChI | InChI=1S/C24H40O5/c1-16(13-15-29-22(28)11-10-21(26)27)6-8-18-17(2)7-9-19-23(3,4)20(25)12-14-24(18,19)5/h16,18-20,25H,2,6-15H2,1,3-5H3,(H,26,27) |
| InChI Key | PEFFBGFCZXFQSX-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCC1C(=C)CCC2C1(CCC(C2(C)C)O)C)CCOC(=O)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names | Butanedioic acid, mono[5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methylpentyl] ester |