Systematic / IUPAC Name: 3-Methyl-5-(5,5,8a-trimethyl-2-methylene-7-oxodecahydro-1-naphthalenyl)pentyl acetate
ID: Reference7393
Other Names:
2(1H)-Naphthalenone, 8-[5-(acetyloxy)-3-methylpentyl]octahydro-4,4,8a-trimethyl-7-methylene-;
5-(5,5,8a-Trimethyl-2-methylidene-7-oxo-hexahydronaphthalen-1-yl)-3-methylpentyl acetate
Formula: C22H36O3
3-Methyl-5-(5,5,8a-trimethyl-2-methylene-7-oxodecahydro-1-naphthalenyl)pentyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 11827 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2018 10:26:29 AM |
| InChI | InChI=1S/C22H36O3/c1-15(11-12-25-17(3)23)7-9-19-16(2)8-10-20-21(4,5)13-18(24)14-22(19,20)6/h15,19-20H,2,7-14H2,1,3-6H3 |
| InChI Key | LZGVQJDYLAUCGI-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCC1C(=C)CCC2C1(CC(=O)CC2(C)C)C)CCOC(=O)C |
| CAS | |
| Splash | |
| Other Names |
2(1H)-Naphthalenone, 8-[5-(acetyloxy)-3-methylpentyl]octahydro-4,4,8a-trimethyl-7-methylene-; 5-(5,5,8a-Trimethyl-2-methylidene-7-oxo-hexahydronaphthalen-1-yl)-3-methylpentyl acetate |