Systematic / IUPAC Name: 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside
ID: Reference7395
Other Names:
AFE;
Kaempferin;
Kaempferol 3-O-α-L-rhamnopyranoside;
Kaempferol 3-O-α-L-rhamnoside;
Kaempferol 3-O-glucorhamnoside
; more
Formula: C21H20O10
Afzelin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 4525 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2018 11:24:29 AM |
| InChI | InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18+,21-/m0/s1 |
| InChI Key | SOSLMHZOJATCCP-AEIZVZFYSA-N |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
| CAS | 482393 |
| Splash | |
| Other Names |
AFE; Kaempferin; Kaempferol 3-O-α-L-rhamnopyranoside; Kaempferol 3-O-α-L-rhamnoside; Kaempferol 3-O-glucorhamnoside; Kaempferol 3-rhamnoside; 4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-; 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-4H-chromen-4-one ; 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-YL]oxy}chromen-4-one |
| ChEMBL | CHEMBL240528 |
| Wikipedia | Afzelin |
| KEGG | C16911 |
| ChemIDPlus | 000482393 |
| ChemSpider | 4475671 |
| PubChem | 5316673 |
| ChEBI | CHEBI:80790 |