Systematic / IUPAC Name: Propan-2-yl 4-hydroxybenzoate
ID: Reference7398
Other Names:
p-Hydroxybenzoic acid isopropyl ester;
p-Oxybenzoesaureisopropylester;
1-Methylethyl 4-hydroxybenzoate;
4-Hydroxybenzoic acid isopropyl ester;
4-Hydroxybenzoic acid, 1-methylethyl ester
; more
Formula: C10H12O3
Class: Extractables/Leachables
Isopropyl 4-hydroxybenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:17:40 AM |
| InChI | InChI=1S/C10H12O3/c1-7(2)13-10(12)8-3-5-9(11)6-4-8/h3-7,11H,1-2H3 |
| InChI Key | CMHMMKSPYOOVGI-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C1=CC=C(C=C1)O |
| CAS | 4191735 |
| Splash | |
| Other Names |
p-Hydroxybenzoic acid isopropyl ester; p-Oxybenzoesaureisopropylester; 1-Methylethyl 4-hydroxybenzoate; 4-Hydroxybenzoic acid isopropyl ester; 4-Hydroxybenzoic acid, 1-methylethyl ester; Benzoic acid, p-hydroxy, isopropyl ester; Benzoic acid, 4-hydroxy, 1-methylethyl ester; Isopropyl p-hydroxybenzoate; Isopropyl-4-hydroxybenzoate; Isopropylhydroxybenzoate; Isopropylparaben; Methylethyl 4-hydroxybenzoate |
| Wikipedia | Isopropylparaben |
| ChEMBL | CHEMBL2333962 |
| ChemIDPlus | 004191735 |
| PubChem | 20161 |
| KEGG | C20343 |
| ChemSpider | 18995 |