Systematic / IUPAC Name: [3,4,5-Trihydroxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate
ID: Reference7401
Other Names:
3,4,5-Trihydroxy-2-(3,4,5-trihydroxyphenylcarbonyloxy)-6-(3,4,5-trihydroxyphenylcarbonyloxymethyl)tetrahydro-2H-pyran;
Hexopyranose, 1,6-bis(3,4,5-trihydroxybenzoate)
Formula: C20H20O14
1,6-Bis-O-(3,4,5-trihydroxybenzoyl)hexopyranose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 6673 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2018 2:08:55 PM |
| InChI | InChI=1S/C20H20O14/c21-8-1-6(2-9(22)13(8)25)18(30)32-5-12-15(27)16(28)17(29)20(33-12)34-19(31)7-3-10(23)14(26)11(24)4-7/h1-4,12,15-17,20-29H,5H2 |
| InChI Key | LYGRISUQIZNHGM-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
3,4,5-Trihydroxy-2-(3,4,5-trihydroxyphenylcarbonyloxy)-6-(3,4,5-trihydroxyphenylcarbonyloxymethyl)tetrahydro-2H-pyran; Hexopyranose, 1,6-bis(3,4,5-trihydroxybenzoate) |