Systematic / IUPAC Name: Ethyl 2-cyano-3,3-diphenylprop-2-enoate
ID: Reference7402
Other Names:
Etocrilene;
Etocrylene;
Uvinul N 35;
α-Carbethoxy-β,β-biscyclopropyl acrylonitrile;
α-Cyano-β-phenylcinnamic acid, ethyl ester
; more
Formula: C18H15NO2
Class: Extractables/Leachables
2-Cyano-3,3-diphenylacrylic acid ethyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:19:01 AM |
| InChI | InChI=1S/C18H15NO2/c1-2-21-18(20)16(13-19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2H2,1H3 |
| InChI Key | IAJNXBNRYMEYAZ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(=C(C1=CC=CC=C1)C2=CC=CC=C2)C#N |
| CAS | 5232995 |
| Splash | |
| Other Names |
Etocrilene; Etocrylene; Uvinul N 35; α-Carbethoxy-β,β-biscyclopropyl acrylonitrile; α-Cyano-β-phenylcinnamic acid, ethyl ester; 2-Cyano-3,3-diphenyl-2-propenoic acid ethyl ester; 2-Propenoic acid, 2-cyano-3,3-diphenyl-, ethyl ester; Acrylic acid, 2-cyano-3,3-diphenyl-, ethyl ester; Acrylonitrile, β, β-biscyclopropyl-,α-carbethoxy-; Acrylonitrile, β,β-biscyclopropyl-α-carbethoxy-; Acrylonitrile, 3,3-dicyclopropyl-2-(ethoxycarbonyl)-; Ethyl α-cyan-β,β-diphenylacrylate; Ethyl α-cyano-β,β-diphenylacrylate; Ethyl (diphenylmethylene)cyanoacetate; Ethyl 2-cyano-3,3-diphenyl-2-propenoate; Ethyl 2-cyano-3,3-diphenylacrylate; Ethyl 2-cyano-3,3-diphenylpropenoate |
| ChemIDPlus | 005232995 |
| KEGG | D04101 |
| ChEMBL | CHEMBL1889451 |
| PubChem | 243274 |
| ChemSpider | 212674 |