Systematic / IUPAC Name: 3,4-Dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)tetrahydrofuran
ID: Reference7414
Other Names: Furan, tetrahydro-3,4-dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)-
Formula: C24H32O7
3,4-Dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)tetrahydrofuran mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 14371 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2018 11:15:01 AM |
| InChI | InChI=1S/C24H32O7/c1-13-14(2)22(16-11-19(27-5)24(30-8)20(12-16)28-6)31-21(13)15-9-17(25-3)23(29-7)18(10-15)26-4/h9-14,21-22H,1-8H3 |
| InChI Key | ZPINJJOPURFFNV-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(C(OC1C2=CC(=C(C(=C2)OC)OC)OC)C3=CC(=C(C(=C3)OC)OC)OC)C |
| CAS | |
| Splash | |
| Other Names | Furan, tetrahydro-3,4-dimethyl-2,5-bis(3,4,5-trimethoxyphenyl)- |
| ChEMBL | CHEMBL1377609 |
| PubChem | 4485701 |
| ChemSpider | 3683513 |