Systematic / IUPAC Name: 3-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)-4H-chromen-4-one
ID: Reference7448
Other Names:
6,8-Diprenylorobol;
4H-1-Benzopyran-4-one, 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)-
Formula: C25H26O6
5,7,3',4'-Tetrahydroxy-6,8-diprenylisoflavone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/22/2018 8:51:47 AM |
| InChI | InChI=1S/C25H26O6/c1-13(2)5-8-16-22(28)17(9-6-14(3)4)25-21(23(16)29)24(30)18(12-31-25)15-7-10-19(26)20(27)11-15/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| InChI Key | OAUIRSVJXOFAOO-UHFFFAOYSA-N |
| Canonical SMILES | CC(=CCC1=C(C2=C(C(=C1O)CC=C(C)C)OC=C(C2=O)C3=CC(=C(C=C3)O)O)O)C |
| CAS | |
| Splash | |
| Other Names |
6,8-Diprenylorobol; 4H-1-Benzopyran-4-one, 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)- |
| PubChem | 21148065 |
| ChemSpider | 20024572 |
| ChEMBL | CHEMBL2442947 |