Systematic / IUPAC Name: Bis(7-methyloctyl) 1,2-cyclohexanedicarboxylate
ID: Reference7453
Other Names:
1,2-Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate;
1,2-Cyclohexanedicarboxylic acid, bis(7-methyloctyl) ester;
Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate;
Bis(7-methyloctyl) tetrahydrophthalate;
Diisononyl cyclohexane-1,2-dicarboxylate
; more
Formula: C26H48O4
Class: Extractables/Leachables
1,2-Cyclohexane dicarboxylic acid diisononyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1459 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:43:12 AM |
| InChI | InChI=1S/C26H48O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h21-24H,5-20H2,1-4H3 |
| InChI Key | HORIEOQXBKUKGQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CCCCCCOC(=O)C1CCCCC1C(=O)OCCCCCCC(C)C |
| CAS | 166412788 |
| Splash | |
| Other Names |
1,2-Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate; 1,2-Cyclohexanedicarboxylic acid, bis(7-methyloctyl) ester; Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate; Bis(7-methyloctyl) tetrahydrophthalate; Diisononyl cyclohexane-1,2-dicarboxylate; Diisononyl hexahydrophthalate; DINCH; Hexamoll DINCH |
| PubChem | 11524680 |
| ChEMBL | CHEMBL3182578 |
| Wikipedia | 1,2-Cyclohexane dicarboxylic acid diisononyl ester |
| ChemSpider | 9699466 |