Systematic / IUPAC Name: 1,5-Anhydro-2-O-(6-O-benzoyl-α-L-galactopyranosyl)-D-glucitol
ID: Reference7459
Other Names: D-Glucitol, 1,5-anhydro-2-O-(6-O-benzoyl-α-L-galactopyranosyl)-
Formula: C19H26O11
1,5-Anhydro-2-O-(6-O-benzoyl-α-L-galactopyranosyl)-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1996 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/23/2018 9:30:31 AM |
| InChI | InChI=1S/C19H26O11/c20-6-10-13(21)14(22)11(7-27-10)29-19-17(25)16(24)15(23)12(30-19)8-28-18(26)9-4-2-1-3-5-9/h1-5,10-17,19-25H,6-8H2/t10-,11+,12+,13-,14-,15-,16-,17+,19-/m1/s1 |
| InChI Key | RXRSNDCGNOOFLH-SADMDIKMSA-N |
| Canonical SMILES | C1C(C(C(C(O1)CO)O)O)OC2C(C(C(C(O2)COC(=O)C3=CC=CC=C3)O)O)O |
| CAS | |
| Splash | |
| Other Names | D-Glucitol, 1,5-anhydro-2-O-(6-O-benzoyl-α-L-galactopyranosyl)- |