Systematic / IUPAC Name: 4-Chloro-2-methylaniline
ID: Reference7461
Other Names:
o-Toluidine, 4-chloro-;
p-Chloro-o-toluidine;
4-Chloro-2-toluidine;
Daito red base TR;
Deval red K
; more
Formula: C7H8ClN
Class: Extractables/Leachables
4-Chloro-2-methylaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS ; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 447 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:45:52 AM |
| InChI | InChI=1S/C7H8ClN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| InChI Key | CXNVOWPRHWWCQR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=C1)Cl)N |
| CAS | 95692 |
| Splash | |
| Other Names |
o-Toluidine, 4-chloro-; p-Chloro-o-toluidine; 4-Chloro-2-toluidine; Daito red base TR; Deval red K; Deval red TR; Fast red TR; Kambamine red TR; 2-Amino-5-chlorotoluene; 2-Methyl-4-chloroaniline; 3-Chloro-6-aminotoluene; 4-Chloro-2-methyl-aniline; 4-Chloro-2-methylbenzeneamine; 4-Chloro-2-methylphenylamine; 4-Chloro-6-methylaniline; 5-Chloro-2-aminotoluene; Azoene fast red TR base; Benzenamine, 4-chloro-2-methyl- |
| ChemSpider | 6981 |
| ChEBI | CHEBI:82276 |
| ChEMBL | CHEMBL3181910 |
| ChemIDPlus | 000095692; 087999302 |
| PubChem | 7251 |
| Wikipedia | 4-Chloro-o-toluidine |
| KEGG | C19169 |