Systematic / IUPAC Name: 3,3'-Dichloro-4,4'-biphenyldiamine
ID: Reference7462
Other Names:
o,o'-Dichlorobenzidine ;
3,3'-Dichlorbenzidin;
3,3'-Dichlorobenzidina;
3,3-Dichlorobenzidine;
Benzidine, 3,3'-dichloro-
; more
Formula: C12H10Cl2N2
Class: Extractables/Leachables
3,3'-Dichlorobenzidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 147 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:46:33 AM |
| InChI | InChI=1S/C12H10Cl2N2/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8/h1-6H,15-16H2 |
| InChI Key | HUWXDEQWWKGHRV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)Cl)Cl)N |
| CAS | 91941 |
| Splash | |
| Other Names |
o,o'-Dichlorobenzidine ; 3,3'-Dichlorbenzidin; 3,3'-Dichlorobenzidina; 3,3-Dichlorobenzidine; Benzidine, 3,3'-dichloro-; Curithane C126; Dichlorobenzidine, 3,3'-; (1,1'-Biphenyl)-4,4'-diamine, 3,3'-dichloro-; 3,3'-Dichloro-(1,1'-biphenyl)-4,4'-diamine; 3,3'-Dichloro-1,1'-biphenyl-4,4'-diamine; 3,3'-Dichloro-4,4'-diamino(1,1-biphenyl); 3,3'-Dichloro-4,4'-diaminobiphenyl; 3,3'-Dichloro-4,4'-diaminodiphenyl; 3,3'-Dichlorobiphenyl-4,4'-diamine; 3,3'-Dichlorobiphenyl-4,4'-ylenediamine; 4-(4-Amino-3-chlorophenyl)-2-chloroaniline; 4-(4-Azanyl-3-chloranyl-phenyl)-2-chloranyl-aniline; 4,4'-Diamino-3,3'-dichlorobiphenyl; 4,4'-Diamino-3,3'-dichlorodiphenyl; 4'-Amino-3,3'-dichloro(1,1'-biphenyl)-4-ylamine |
| ChEBI | CHEBI:82315 |
| ChemSpider | 6803 |
| PubChem | 7070 |
| ChemIDPlus | 000091941; 086349588 |
| Wikipedia | 3,3'-Dichlorobenzidine |
| ChEMBL | CHEMBL314470 |
| KEGG | C19225 |