Systematic / IUPAC Name: 4-[(4-Amino-3-chlorophenyl)methyl]-2-chloroaniline
ID: Reference7463
Other Names:
BOCA;
Cuamine m;
Curalin m;
Curene 442;
Cyanaset
; more
Formula: C13H12Cl2N2
Class: Extractables/Leachables
4,4'-Methylenebis(2-chloroaniline) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:47:03 AM |
| InChI | InChI=1S/C13H12Cl2N2/c14-10-6-8(1-3-12(10)16)5-9-2-4-13(17)11(15)7-9/h1-4,6-7H,5,16-17H2 |
| InChI Key | IBOFVQJTBBUKMU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)N)Cl)Cl)N |
| CAS | 101144 |
| Splash | |
| Other Names |
BOCA; Cuamine m; Curalin m; Curene 442; Cyanaset; Diamet Kh; Mboca; Millionate m; MOCA; Quodorole; 2,2'-Dichloro-4,4'-methylendianiline; 2,2'Dichloro-4,4'-methylene dianiline; 3,3'-Dichlor-4,4'-diaminodiphenylmethan; 3,3'-Dichloro-4,4'-diaminodiphenyl methane; 4,4'-Diamino-3,3'-dichlorodiphenyl methane; 4,4-Diamino-3,3-dichlorodiphenylmethane; 4,4'-Methanediylbis(2-chloroaniline); 4,4'-Methylene bis(2-chloroaniline); 4,4-Methylene bis(2-chloroaniline); 4,4'-Methylene(bis)-chloroaniline; 4,4'-Methylenebis(o-chloroaniline); 4,4'-Methylenebis(2-chlorobenzenamine); 4,4'-Methylene-bis-2-chloroaniline; 4,4'-Methylenebis-2-chlorobenzenamine; Aniline, 4,4'-methylenebis(2-chloro-; Benzenamine, 4,4'-methylenebis(2-chloro-; Bis(3-chloro-4-aminophenyl)methane; Bis(4-amino-3-chlorophenyl)methane; Methylene 4,4'-bis(o-chloroaniline); Methylenebis(2-chloroaniline); Methylene-bis(2-chloroaniline), 4,4'-; Methylenebis(3-chloro-4-aminobenzene); Methylenebis(chloroaniline) |
| ChEMBL | CHEMBL82846 |
| PubChem | 7543 |
| ChEBI | CHEBI:28124 |
| KEGG | C10999 |
| Wikipedia | 4,4'-Methylenebis(2-chloroaniline) |
| ChemIDPlus | 000101144 |
| ChemSpider | 7262 |